2-(Phenylthio)aniline
Catalog No: FT-0691285
CAS No: 6764-13-2
- Chemical Name: 2-(Phenylthio)aniline
- Molecular Formula: C12H12ClNS
- Molecular Weight: 237.75
- InChI Key: XCFXJRCTEOTOJD-UHFFFAOYSA-N
- InChI: InChI=1S/C12H11NS.ClH/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10;/h1-9H,13H2;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 43ºC(lit.) |
|---|---|
| CAS: | 6764-13-2 |
| MF: | C12H12ClNS |
| Flash_Point: | 153.7ºC |
| Product_Name: | 2-phenylsulfanylaniline,hydrochloride |
| Density: | 1.19 g/cm C |
| FW: | 237.74800 |
| Bolling_Point: | 330.5ºC at 760 mmHg |
| Melting_Point: | 43ºC(lit.) |
|---|---|
| MF: | C12H12ClNS |
| Flash_Point: | 153.7ºC |
| LogP: | 4.80320 |
| FW: | 237.74800 |
| Density: | 1.19 g/cm C |
| PSA: | 51.32000 |
| Bolling_Point: | 330.5ºC at 760 mmHg |
| Exact_Mass: | 237.03800 |
| RIDADR: | UN 3077 9/PG 3 |
|---|---|
| Hazard_Codes: | Xi: Irritant;N: Dangerous for the environment; |
| HS_Code: | 2930909090 |
| Risk_Statements(EU): | R43;R51/53 |
| Safety_Statements: | 24-37-61 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)